About naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate
naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate (PubChem CID 42384969) has the molecular formula C23H19NO3
and a molecular weight of 357.41 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate |
| PubChem CID | 42384969 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate |
| SMILES | C=C1c2ccccc2C(=O)N1CCC(=O)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C23H19NO3/c1-16-19-10-4-5-12-21(19)23(26)24(16)14-13-22(25)27-15-18-9-6-8-17-7-2-3-11-20(17)18/h2-12H,1,13-15H2 |
| InChIKey | MMCXXDCNXUZLBE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate?
The IUPAC name of naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate (CID 42384969) is naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate.
What is the SMILES notation for naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate?
The canonical SMILES for naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate is C=C1c2ccccc2C(=O)N1CCC(=O)OCc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate?
The InChIKey is MMCXXDCNXUZLBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO3/c1-16-19-10-4-5-12-21(19)23(26)24(16)14-13-22(25)27-15-18-9-6-8-17-7-2-3-11-20(17)18/h2-12H,1,13-15H2.
What are the key properties of naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate?
naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate has a molecular weight of 357.41 g/mol, XLogP of 4.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylmethyl 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate is sourced from PubChem (CID 42384969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).