C23H18N2O4 — CID 42386965
6-methyl-N'-(2-naphthalen-1-ylacetyl)-4-oxochromene-2-carbohydrazide (PubChem CID 42386965) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 6-methyl-N'-(2-naphthalen-1-ylacetyl)-4-oxochromene-2-carbohydrazide.
| Compound Name | 6-methyl-N'-(2-naphthalen-1-ylacetyl)-4-oxochromene-2-carbohydrazide |
|---|---|
| PubChem CID | 42386965 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 6-methyl-N'-(2-naphthalen-1-ylacetyl)-4-oxochromene-2-carbohydrazide |
| SMILES | Cc1ccc2oc(C(=O)NNC(=O)Cc3cccc4ccccc34)cc(=O)c2c1 |
| InChI | InChI=1S/C23H18N2O4/c1-14-9-10-20-18(11-14)19(26)13-21(29-20)23(28)25-24-22(27)12-16-7-4-6-15-5-2-3-8-17(15)16/h2-11,13H,12H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | CTZKXPVTKRNFIE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|