C19H22Cl3N3O2S — CID 42388791
2,5-dichloro-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]benzenesulfonamide (PubChem CID 42388791) has the molecular formula C19H22Cl3N3O2S and a molecular weight of 462.83 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42388791 |
| Molecular Formula | C19H22Cl3N3O2S |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 2,5-dichloro-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2ccc(Cl)cc2)CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H22Cl3N3O2S/c20-15-2-5-17(6-3-15)25-12-10-24(11-13-25)9-1-8-23-28(26,27)19-14-16(21)4-7-18(19)22/h2-7,14,23H,1,8-13H2 |
| InChIKey | AIHNQVWRMBLBEM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|