C18H19NO8 — CID 4238890
dimethyl 1-(4-methoxyphenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,3-dicarboxylate (PubChem CID 4238890) has the molecular formula C18H19NO8 and a molecular weight of 377.35 g/mol. Its IUPAC name is dimethyl 1-(4-methoxyphenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,3-dicarboxylate.
| Compound Name | dimethyl 1-(4-methoxyphenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 4238890 |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | dimethyl 1-(4-methoxyphenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)OC(c2ccc(OC)cc2)C2C(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C18H19NO8/c1-19-14(20)11-12(15(19)21)18(16(22)25-3,17(23)26-4)27-13(11)9-5-7-10(24-2)8-6-9/h5-8,11-13H,1-4H3 |
| InChIKey | BABFQGSVMPHVNB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|