C9H6F6N2OS — CID 4238978
1,1,1,3,3,3-hexafluoro-2-(6-methylimidazo[2,1-b][1,3]thiazol-2-yl)propan-2-ol (PubChem CID 4238978) has the molecular formula C9H6F6N2OS and a molecular weight of 304.22 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(6-methylimidazo[2,1-b][1,3]thiazol-2-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(6-methylimidazo[2,1-b][1,3]thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 4238978 |
| Molecular Formula | C9H6F6N2OS |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(6-methylimidazo[2,1-b][1,3]thiazol-2-yl)propan-2-ol |
| SMILES | Cc1cn2cc(C(O)(C(F)(F)F)C(F)(F)F)sc2n1 |
| InChI | InChI=1S/C9H6F6N2OS/c1-4-2-17-3-5(19-6(17)16-4)7(18,8(10,11)12)9(13,14)15/h2-3,18H,1H3 |
| InChIKey | AMWBXSIGTONWOX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |