C23H30N4O3 — CID 42390414
N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-N'-(2-methylphenyl)oxamide (PubChem CID 42390414) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-N'-(2-methylphenyl)oxamide.
| Compound Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 42390414 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-N'-(2-methylphenyl)oxamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)C(=O)Nc3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-18-6-3-4-7-21(18)25-23(29)22(28)24-12-5-13-26-14-16-27(17-15-26)19-8-10-20(30-2)11-9-19/h3-4,6-11H,5,12-17H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | BQSZAUAZTADQBD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|