C26H30N2O2 — CID 42394081
N-[4-(3-methylphenyl)phenyl]-1-[(2R)-spiro[2.3]hexane-2-carbonyl]piperidine-4-carboxamide (PubChem CID 42394081) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[4-(3-methylphenyl)phenyl]-1-[(2R)-spiro[2.3]hexane-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(3-methylphenyl)phenyl]-1-[(2R)-spiro[2.3]hexane-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42394081 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-[4-(3-methylphenyl)phenyl]-1-[(2R)-spiro[2.3]hexane-2-carbonyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(-c2ccc(NC(=O)C3CCN(C(=O)[C@@H]4CC45CCC5)CC3)cc2)c1 |
| InChI | InChI=1S/C26H30N2O2/c1-18-4-2-5-21(16-18)19-6-8-22(9-7-19)27-24(29)20-10-14-28(15-11-20)25(30)23-17-26(23)12-3-13-26/h2,4-9,16,20,23H,3,10-15,17H2,1H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | AXBMWPSEHQZWPH-QHCPKHFHSA-N |
| XLogP | 5.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |