C25H29N5O3S — CID 4239567
N-[1-[5-[2-(2-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-4-methoxybenzamide (PubChem CID 4239567) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is N-[1-[5-[2-(2-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-4-methoxybenzamide.
| Compound Name | N-[1-[5-[2-(2-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4239567 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[1-[5-[2-(2-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-4-methoxybenzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2CC)nnc1C(C)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H29N5O3S/c1-5-15-30-23(17(3)26-24(32)19-11-13-20(33-4)14-12-19)28-29-25(30)34-16-22(31)27-21-10-8-7-9-18(21)6-2/h5,7-14,17H,1,6,15-16H2,2-4H3,(H,26,32)(H,27,31) |
| InChIKey | WWBWIMOVYFJDJL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|