C14H17F6N3O — CID 4239722
N-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]-3-methylbutanamide (PubChem CID 4239722) has the molecular formula C14H17F6N3O and a molecular weight of 357.30 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]-3-methylbutanamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 4239722 |
| Molecular Formula | C14H17F6N3O |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]-3-methylbutanamide |
| SMILES | Cc1cccc(NC(NC(=O)CC(C)C)(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H17F6N3O/c1-8(2)7-11(24)23-12(13(15,16)17,14(18,19)20)22-10-6-4-5-9(3)21-10/h4-6,8H,7H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | RUGJIDYNNPHZOB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|