C21H22FNO2S — CID 42402854
1-[(3S)-3-(3-fluoro-4-phenylbenzoyl)piperidin-1-yl]-2-methylsulfanylethanone (PubChem CID 42402854) has the molecular formula C21H22FNO2S and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[(3S)-3-(3-fluoro-4-phenylbenzoyl)piperidin-1-yl]-2-methylsulfanylethanone.
| Compound Name | 1-[(3S)-3-(3-fluoro-4-phenylbenzoyl)piperidin-1-yl]-2-methylsulfanylethanone |
|---|---|
| PubChem CID | 42402854 |
| Molecular Formula | C21H22FNO2S |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-[(3S)-3-(3-fluoro-4-phenylbenzoyl)piperidin-1-yl]-2-methylsulfanylethanone |
| SMILES | CSCC(=O)N1CCC[C@H](C(=O)c2ccc(-c3ccccc3)c(F)c2)C1 |
| InChI | InChI=1S/C21H22FNO2S/c1-26-14-20(24)23-11-5-8-17(13-23)21(25)16-9-10-18(19(22)12-16)15-6-3-2-4-7-15/h2-4,6-7,9-10,12,17H,5,8,11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | RAFKWZBREHVIQR-KRWDZBQOSA-N |
| XLogP | 4.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |