C21H25FN2O3 — CID 42403520
2-[1-[(2-fluorophenyl)methyl]-2-methyl-4-oxo-6,7-dihydro-5H-indol-3-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 42403520) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]-2-methyl-4-oxo-6,7-dihydro-5H-indol-3-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]-2-methyl-4-oxo-6,7-dihydro-5H-indol-3-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 42403520 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]-2-methyl-4-oxo-6,7-dihydro-5H-indol-3-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cc1c2c(n(Cc3ccccc3F)c1C)CCCC2=O |
| InChI | InChI=1S/C21H25FN2O3/c1-14-16(12-20(26)23-10-11-27-2)21-18(8-5-9-19(21)25)24(14)13-15-6-3-4-7-17(15)22/h3-4,6-7H,5,8-13H2,1-2H3,(H,23,26) |
| InChIKey | BAMDJKSYXGXWDV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|