C24H27FN2O — CID 42403686
N-[(2-fluorophenyl)methyl]-3-[(3S)-1-(3-phenylprop-2-ynyl)piperidin-3-yl]propanamide (PubChem CID 42403686) has the molecular formula C24H27FN2O and a molecular weight of 378.49 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3-[(3S)-1-(3-phenylprop-2-ynyl)piperidin-3-yl]propanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-3-[(3S)-1-(3-phenylprop-2-ynyl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 42403686 |
| Molecular Formula | C24H27FN2O |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3-[(3S)-1-(3-phenylprop-2-ynyl)piperidin-3-yl]propanamide |
| SMILES | O=C(CC[C@@H]1CCCN(CC#Cc2ccccc2)C1)NCc1ccccc1F |
| InChI | InChI=1S/C24H27FN2O/c25-23-13-5-4-12-22(23)18-26-24(28)15-14-21-11-7-17-27(19-21)16-6-10-20-8-2-1-3-9-20/h1-5,8-9,12-13,21H,7,11,14-19H2,(H,26,28)/t21-/m0/s1 |
| InChIKey | YVLVFAKYDPAXBC-NRFANRHFSA-N |
| XLogP | 3.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|