C26H20F3N3O3 — CID 42406464
2,3,6-trifluoro-N-[[5-methyl-2-[4-[(2-phenylacetyl)amino]phenyl]-1,3-oxazol-4-yl]methyl]benzamide (PubChem CID 42406464) has the molecular formula C26H20F3N3O3 and a molecular weight of 479.46 g/mol. Its IUPAC name is 2,3,6-trifluoro-N-[[5-methyl-2-[4-[(2-phenylacetyl)amino]phenyl]-1,3-oxazol-4-yl]methyl]benzamide.
| Compound Name | 2,3,6-trifluoro-N-[[5-methyl-2-[4-[(2-phenylacetyl)amino]phenyl]-1,3-oxazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42406464 |
| Molecular Formula | C26H20F3N3O3 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2,3,6-trifluoro-N-[[5-methyl-2-[4-[(2-phenylacetyl)amino]phenyl]-1,3-oxazol-4-yl]methyl]benzamide |
| SMILES | Cc1oc(-c2ccc(NC(=O)Cc3ccccc3)cc2)nc1CNC(=O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C26H20F3N3O3/c1-15-21(14-30-25(34)23-19(27)11-12-20(28)24(23)29)32-26(35-15)17-7-9-18(10-8-17)31-22(33)13-16-5-3-2-4-6-16/h2-12H,13-14H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | CNIMUEFVYSRUTO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|