C22H28N2O5S — CID 4240708
3-[[3-(dibutylsulfamoyl)benzoyl]amino]benzoic acid (PubChem CID 4240708) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is 3-[[3-(dibutylsulfamoyl)benzoyl]amino]benzoic acid.
| Compound Name | 3-[[3-(dibutylsulfamoyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4240708 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-[[3-(dibutylsulfamoyl)benzoyl]amino]benzoic acid |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1cccc(C(=O)Nc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C22H28N2O5S/c1-3-5-13-24(14-6-4-2)30(28,29)20-12-8-9-17(16-20)21(25)23-19-11-7-10-18(15-19)22(26)27/h7-12,15-16H,3-6,13-14H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | PEJHORUWNJAQKB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |