C25H38N2O3 — CID 42407522
N-[(1R,2R)-2-(2-methoxyethoxy)-1'-[(E)-2-methylbut-2-enyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylpropanamide (PubChem CID 42407522) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is N-[(1R,2R)-2-(2-methoxyethoxy)-1'-[(E)-2-methylbut-2-enyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylpropanamide.
| Compound Name | N-[(1R,2R)-2-(2-methoxyethoxy)-1'-[(E)-2-methylbut-2-enyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 42407522 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | N-[(1R,2R)-2-(2-methoxyethoxy)-1'-[(E)-2-methylbut-2-enyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylpropanamide |
| SMILES | C/C=C(\C)CN1CCC2(CC1)c1ccccc1[C@@H](NC(=O)C(C)C)[C@@H]2OCCOC |
| InChI | InChI=1S/C25H38N2O3/c1-6-19(4)17-27-13-11-25(12-14-27)21-10-8-7-9-20(21)22(26-24(28)18(2)3)23(25)30-16-15-29-5/h6-10,18,22-23H,11-17H2,1-5H3,(H,26,28)/b19-6+/t22-,23+/m1/s1 |
| InChIKey | NWYAFFLJGVZAHY-PBBAFTKJSA-N |
| XLogP | 3.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|