C17H20ClN5O3S — CID 42410883
N-(2-chloro-5-nitrophenyl)-2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 42410883) has the molecular formula C17H20ClN5O3S and a molecular weight of 409.90 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 42410883 |
| Molecular Formula | C17H20ClN5O3S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(CCC2CCCC2)n1)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H20ClN5O3S/c18-13-7-6-12(23(25)26)9-14(13)19-16(24)10-27-17-20-15(21-22-17)8-5-11-3-1-2-4-11/h6-7,9,11H,1-5,8,10H2,(H,19,24)(H,20,21,22) |
| InChIKey | HMNMUPWOVWMBDK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|