C26H24Cl2N4OS — CID 4241202
N-[1-[5-benzylsulfanyl-4-(5-chloro-2-methylphenyl)-1,2,4-triazol-3-yl]ethyl]-2-chloro-2-phenylacetamide (PubChem CID 4241202) has the molecular formula C26H24Cl2N4OS and a molecular weight of 511.48 g/mol. Its IUPAC name is N-[1-[5-benzylsulfanyl-4-(5-chloro-2-methylphenyl)-1,2,4-triazol-3-yl]ethyl]-2-chloro-2-phenylacetamide.
| Compound Name | N-[1-[5-benzylsulfanyl-4-(5-chloro-2-methylphenyl)-1,2,4-triazol-3-yl]ethyl]-2-chloro-2-phenylacetamide |
|---|---|
| PubChem CID | 4241202 |
| Molecular Formula | C26H24Cl2N4OS |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | N-[1-[5-benzylsulfanyl-4-(5-chloro-2-methylphenyl)-1,2,4-triazol-3-yl]ethyl]-2-chloro-2-phenylacetamide |
| SMILES | Cc1ccc(Cl)cc1-n1c(SCc2ccccc2)nnc1C(C)NC(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C26H24Cl2N4OS/c1-17-13-14-21(27)15-22(17)32-24(30-31-26(32)34-16-19-9-5-3-6-10-19)18(2)29-25(33)23(28)20-11-7-4-8-12-20/h3-15,18,23H,16H2,1-2H3,(H,29,33) |
| InChIKey | POIHOZNYVOCOMG-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|