C23H27ClN2O2 — CID 42414912
N-[(2R)-2-(4-chlorophenyl)-2-piperidin-1-ylethyl]-4-prop-2-enoxybenzamide (PubChem CID 42414912) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is N-[(2R)-2-(4-chlorophenyl)-2-piperidin-1-ylethyl]-4-prop-2-enoxybenzamide.
| Compound Name | N-[(2R)-2-(4-chlorophenyl)-2-piperidin-1-ylethyl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 42414912 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[(2R)-2-(4-chlorophenyl)-2-piperidin-1-ylethyl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NC[C@@H](c2ccc(Cl)cc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-2-16-28-21-12-8-19(9-13-21)23(27)25-17-22(26-14-4-3-5-15-26)18-6-10-20(24)11-7-18/h2,6-13,22H,1,3-5,14-17H2,(H,25,27)/t22-/m0/s1 |
| InChIKey | DXHSFMVTJIRKJT-QFIPXVFZSA-N |
| XLogP | 4.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|