C23H27ClN2O2S — CID 42415691
N-[(2-chlorophenyl)methyl]-3-[(3R)-1-(4-methylsulfanylbenzoyl)piperidin-3-yl]propanamide (PubChem CID 42415691) has the molecular formula C23H27ClN2O2S and a molecular weight of 431.00 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-[(3R)-1-(4-methylsulfanylbenzoyl)piperidin-3-yl]propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-[(3R)-1-(4-methylsulfanylbenzoyl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 42415691 |
| Molecular Formula | C23H27ClN2O2S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-[(3R)-1-(4-methylsulfanylbenzoyl)piperidin-3-yl]propanamide |
| SMILES | CSc1ccc(C(=O)N2CCC[C@H](CCC(=O)NCc3ccccc3Cl)C2)cc1 |
| InChI | InChI=1S/C23H27ClN2O2S/c1-29-20-11-9-18(10-12-20)23(28)26-14-4-5-17(16-26)8-13-22(27)25-15-19-6-2-3-7-21(19)24/h2-3,6-7,9-12,17H,4-5,8,13-16H2,1H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | MYVQAKCSRSTTIS-QGZVFWFLSA-N |
| XLogP | 5.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |