C17H18FN3O3 — CID 42416095
(4S)-4-(3-fluorophenyl)-6-[[(2S)-oxolan-2-yl]methyl]-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 42416095) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is (4S)-4-(3-fluorophenyl)-6-[[(2S)-oxolan-2-yl]methyl]-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | (4S)-4-(3-fluorophenyl)-6-[[(2S)-oxolan-2-yl]methyl]-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 42416095 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (4S)-4-(3-fluorophenyl)-6-[[(2S)-oxolan-2-yl]methyl]-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)N(C[C@@H]3CCCO3)C2)[C@H](c2cccc(F)c2)N1 |
| InChI | InChI=1S/C17H18FN3O3/c18-11-4-1-3-10(7-11)15-14-13(19-17(23)20-15)9-21(16(14)22)8-12-5-2-6-24-12/h1,3-4,7,12,15H,2,5-6,8-9H2,(H2,19,20,23)/t12-,15-/m0/s1 |
| InChIKey | KZLQTEGPKPTQSG-WFASDCNBSA-N |
| XLogP | 1.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |