C21H34N4OS2 — CID 4241713
N-(5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 4241713) has the molecular formula C21H34N4OS2 and a molecular weight of 422.66 g/mol. Its IUPAC name is N-(5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4241713 |
| Molecular Formula | C21H34N4OS2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-(5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCCCSc1nc(NCCCN(C)C)c2c3c(sc2n1)COC(C)(CC)C3 |
| InChI | InChI=1S/C21H34N4OS2/c1-6-8-12-27-20-23-18(22-10-9-11-25(4)5)17-15-13-21(3,7-2)26-14-16(15)28-19(17)24-20/h6-14H2,1-5H3,(H,22,23,24) |
| InChIKey | KYXAJDYQBKXAKG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|