C26H21NO3 — CID 42417778
N-[[(2S)-5-(2-acetylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-phenylprop-2-ynamide (PubChem CID 42417778) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[[(2S)-5-(2-acetylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-phenylprop-2-ynamide.
| Compound Name | N-[[(2S)-5-(2-acetylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-phenylprop-2-ynamide |
|---|---|
| PubChem CID | 42417778 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[[(2S)-5-(2-acetylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-phenylprop-2-ynamide |
| SMILES | CC(=O)c1ccccc1-c1ccc2c(c1)C[C@@H](CNC(=O)C#Cc1ccccc1)O2 |
| InChI | InChI=1S/C26H21NO3/c1-18(28)23-9-5-6-10-24(23)20-12-13-25-21(15-20)16-22(30-25)17-27-26(29)14-11-19-7-3-2-4-8-19/h2-10,12-13,15,22H,16-17H2,1H3,(H,27,29)/t22-/m0/s1 |
| InChIKey | JEMGASSQGVGLJO-QFIPXVFZSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|