C23H30N2O4 — CID 4242263
1-[(2,5-dimethoxyphenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 4242263) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(2,5-dimethoxyphenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4242263 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(OC)c(C(c2ccc(N(C)C)cc2)N2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-24(2)18-7-5-16(6-8-18)22(25-13-11-17(12-14-25)23(26)27)20-15-19(28-3)9-10-21(20)29-4/h5-10,15,17,22H,11-14H2,1-4H3,(H,26,27) |
| InChIKey | IMFDWDZDMGMNLX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|