C23H27N5O4 — CID 42423261
5-cyclopropyl-1-[4-(2,5-dimethoxyphenyl)pyrimidin-2-yl]-N-(3-methoxypropyl)pyrazole-4-carboxamide (PubChem CID 42423261) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 5-cyclopropyl-1-[4-(2,5-dimethoxyphenyl)pyrimidin-2-yl]-N-(3-methoxypropyl)pyrazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-1-[4-(2,5-dimethoxyphenyl)pyrimidin-2-yl]-N-(3-methoxypropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42423261 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 5-cyclopropyl-1-[4-(2,5-dimethoxyphenyl)pyrimidin-2-yl]-N-(3-methoxypropyl)pyrazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1cnn(-c2nccc(-c3cc(OC)ccc3OC)n2)c1C1CC1 |
| InChI | InChI=1S/C23H27N5O4/c1-30-12-4-10-24-22(29)18-14-26-28(21(18)15-5-6-15)23-25-11-9-19(27-23)17-13-16(31-2)7-8-20(17)32-3/h7-9,11,13-15H,4-6,10,12H2,1-3H3,(H,24,29) |
| InChIKey | DUZDZWWQYBAEPP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|