C15H10BrFN2O2S — CID 42426611
(5R)-5-(2-bromoanilino)-3-(4-fluorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 42426611) has the molecular formula C15H10BrFN2O2S and a molecular weight of 381.23 g/mol. Its IUPAC name is (5R)-5-(2-bromoanilino)-3-(4-fluorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-(2-bromoanilino)-3-(4-fluorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 42426611 |
| Molecular Formula | C15H10BrFN2O2S |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | (5R)-5-(2-bromoanilino)-3-(4-fluorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S[C@@H](Nc2ccccc2Br)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10BrFN2O2S/c16-11-3-1-2-4-12(11)18-13-14(20)19(15(21)22-13)10-7-5-9(17)6-8-10/h1-8,13,18H/t13-/m1/s1 |
| InChIKey | MTLWFMPLJQADBE-CYBMUJFWSA-N |
| XLogP | 4.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|