C28H32N4O3 — CID 42429572
7-[[2-(1H-indol-3-yl)ethylamino]methyl]-5-(2-piperidin-1-ylethyl)-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 42429572) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 7-[[2-(1H-indol-3-yl)ethylamino]methyl]-5-(2-piperidin-1-ylethyl)-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 7-[[2-(1H-indol-3-yl)ethylamino]methyl]-5-(2-piperidin-1-ylethyl)-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 42429572 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 7-[[2-(1H-indol-3-yl)ethylamino]methyl]-5-(2-piperidin-1-ylethyl)-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | O=c1c(CNCCc2c[nH]c3ccccc23)cc2cc3c(cc2n1CCN1CCCCC1)OCO3 |
| InChI | InChI=1S/C28H32N4O3/c33-28-22(17-29-9-8-20-18-30-24-7-3-2-6-23(20)24)14-21-15-26-27(35-19-34-26)16-25(21)32(28)13-12-31-10-4-1-5-11-31/h2-3,6-7,14-16,18,29-30H,1,4-5,8-13,17,19H2 |
| InChIKey | GQUBQUAYUSZIHE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|