C22H19ClN2OS — CID 42429922
1-(4-chlorophenyl)-N-[(7-methoxy-2-thiophen-3-ylquinolin-3-yl)methyl]methanamine (PubChem CID 42429922) has the molecular formula C22H19ClN2OS and a molecular weight of 394.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(7-methoxy-2-thiophen-3-ylquinolin-3-yl)methyl]methanamine.
| Compound Name | 1-(4-chlorophenyl)-N-[(7-methoxy-2-thiophen-3-ylquinolin-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 42429922 |
| Molecular Formula | C22H19ClN2OS |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(7-methoxy-2-thiophen-3-ylquinolin-3-yl)methyl]methanamine |
| SMILES | COc1ccc2cc(CNCc3ccc(Cl)cc3)c(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C22H19ClN2OS/c1-26-20-7-4-16-10-18(13-24-12-15-2-5-19(23)6-3-15)22(25-21(16)11-20)17-8-9-27-14-17/h2-11,14,24H,12-13H2,1H3 |
| InChIKey | WAGYXCGXJVEIFG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |