About 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol
4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol (PubChem CID 42429926) has the molecular formula C22H19NO2S2
and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol.
Molecular Properties
| Compound Name | 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol |
| PubChem CID | 42429926 |
| Molecular Formula | C22H19NO2S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol |
| SMILES | Oc1cc(-c2cccs2)cc2c1OCCN(Cc1cc3ccccc3s1)C2 |
| InChI | InChI=1S/C22H19NO2S2/c24-19-12-16(20-6-3-9-26-20)10-17-13-23(7-8-25-22(17)19)14-18-11-15-4-1-2-5-21(15)27-18/h1-6,9-12,24H,7-8,13-14H2 |
| InChIKey | RHXPQTYRDKZQIO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol?
The IUPAC name of 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol (CID 42429926) is 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol.
What is the SMILES notation for 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol?
The canonical SMILES for 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol is Oc1cc(-c2cccs2)cc2c1OCCN(Cc1cc3ccccc3s1)C2.
What is the InChIKey of 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol?
The InChIKey is RHXPQTYRDKZQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO2S2/c24-19-12-16(20-6-3-9-26-20)10-17-13-23(7-8-25-22(17)19)14-18-11-15-4-1-2-5-21(15)27-18/h1-6,9-12,24H,7-8,13-14H2.
What are the key properties of 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol?
4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol has a molecular weight of 393.53 g/mol, XLogP of 5.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzothiophen-2-ylmethyl)-7-thiophen-2-yl-3,5-dihydro-2H-1,4-benzoxazepin-9-ol is sourced from PubChem (CID 42429926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).