C22H25NO3S — CID 42430724
1-[9-but-3-ynoxy-7-(5-methylthiophen-2-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one (PubChem CID 42430724) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is 1-[9-but-3-ynoxy-7-(5-methylthiophen-2-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[9-but-3-ynoxy-7-(5-methylthiophen-2-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 42430724 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-[9-but-3-ynoxy-7-(5-methylthiophen-2-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-methylpropan-1-one |
| SMILES | C#CCCOc1cc(-c2ccc(C)s2)cc2c1OCCN(C(=O)C(C)C)C2 |
| InChI | InChI=1S/C22H25NO3S/c1-5-6-10-25-19-13-17(20-8-7-16(4)27-20)12-18-14-23(22(24)15(2)3)9-11-26-21(18)19/h1,7-8,12-13,15H,6,9-11,14H2,2-4H3 |
| InChIKey | QVLWGCUKNCGWHM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|