C13H10N2O+2 — CID 4243078
5,8-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,8,10,12-hexaen-15-one (PubChem CID 4243078) has the molecular formula C13H10N2O+2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 5,8-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,8,10,12-hexaen-15-one.
| Compound Name | 5,8-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,8,10,12-hexaen-15-one |
|---|---|
| PubChem CID | 4243078 |
| Molecular Formula | C13H10N2O+2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5,8-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,8,10,12-hexaen-15-one |
| SMILES | O=C1c2ccc[n+]3c2-c2c1ccc[n+]2CC3 |
| InChI | InChI=1S/C13H10N2O/c16-13-9-3-1-5-14-7-8-15-6-2-4-10(13)12(15)11(9)14/h1-6H,7-8H2/q+2 |
| InChIKey | CTGQTVWSMPEGCL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|