C31H33N3O — CID 42434571
(4aR,8aS)-1-(2,2-diphenylethyl)-6-(1H-indol-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 42434571) has the molecular formula C31H33N3O and a molecular weight of 463.63 g/mol. Its IUPAC name is (4aR,8aS)-1-(2,2-diphenylethyl)-6-(1H-indol-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-(2,2-diphenylethyl)-6-(1H-indol-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 42434571 |
| Molecular Formula | C31H33N3O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | (4aR,8aS)-1-(2,2-diphenylethyl)-6-(1H-indol-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CN(Cc3cc4ccccc4[nH]3)CC[C@@H]2N1CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H33N3O/c35-31-16-15-26-20-33(21-27-19-25-13-7-8-14-29(25)32-27)18-17-30(26)34(31)22-28(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-14,19,26,28,30,32H,15-18,20-22H2/t26-,30+/m1/s1 |
| InChIKey | JXPNFJWFMGZSQD-VIZCGCQYSA-N |
| XLogP | 5.81 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |