About (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol
(2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol (PubChem CID 42435274) has the molecular formula C19H28N4O
and a molecular weight of 328.46 g/mol. Its IUPAC name is (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol |
| PubChem CID | 42435274 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol |
| SMILES | CC[C@@H](O)CNC1CCN(c2nc(C)c3cc(C)ccc3n2)CC1 |
| InChI | InChI=1S/C19H28N4O/c1-4-16(24)12-20-15-7-9-23(10-8-15)19-21-14(3)17-11-13(2)5-6-18(17)22-19/h5-6,11,15-16,20,24H,4,7-10,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | YDHQCFVXDBGAQR-MRXNPFEDSA-N |
| XLogP | 2.58 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol?
The IUPAC name of (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol (CID 42435274) is (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol.
What is the SMILES notation for (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol?
The canonical SMILES for (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol is CC[C@@H](O)CNC1CCN(c2nc(C)c3cc(C)ccc3n2)CC1.
What is the InChIKey of (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol?
The InChIKey is YDHQCFVXDBGAQR-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H28N4O/c1-4-16(24)12-20-15-7-9-23(10-8-15)19-21-14(3)17-11-13(2)5-6-18(17)22-19/h5-6,11,15-16,20,24H,4,7-10,12H2,1-3H3/t16-/m1/s1.
What are the key properties of (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol?
(2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol has a molecular weight of 328.46 g/mol, XLogP of 2.58, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[[1-(4,6-dimethylquinazolin-2-yl)piperidin-4-yl]amino]butan-2-ol is sourced from PubChem (CID 42435274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).