About 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea
1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea (PubChem CID 4243595) has the molecular formula C10H11N5O
and a molecular weight of 217.23 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea |
| PubChem CID | 4243595 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C10H11N5O/c1-8-2-4-9(5-3-8)13-10(16)14-15-6-11-12-7-15/h2-7H,1H3,(H2,13,14,16) |
| InChIKey | RXLKOGAEWHHHKQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea?
The IUPAC name of 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea (CID 4243595) is 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea.
What is the SMILES notation for 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea?
The canonical SMILES for 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea is Cc1ccc(NC(=O)Nn2cnnc2)cc1.
What is the InChIKey of 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea?
The InChIKey is RXLKOGAEWHHHKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O/c1-8-2-4-9(5-3-8)13-10(16)14-15-6-11-12-7-15/h2-7H,1H3,(H2,13,14,16).
What are the key properties of 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea?
1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea has a molecular weight of 217.23 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea is sourced from PubChem (CID 4243595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).