C17H25N3O — CID 42436394
(5S)-5-[2-(prop-2-enylamino)ethyl]-1-(3-pyridin-4-ylpropyl)pyrrolidin-2-one (PubChem CID 42436394) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (5S)-5-[2-(prop-2-enylamino)ethyl]-1-(3-pyridin-4-ylpropyl)pyrrolidin-2-one.
| Compound Name | (5S)-5-[2-(prop-2-enylamino)ethyl]-1-(3-pyridin-4-ylpropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 42436394 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (5S)-5-[2-(prop-2-enylamino)ethyl]-1-(3-pyridin-4-ylpropyl)pyrrolidin-2-one |
| SMILES | C=CCNCC[C@@H]1CCC(=O)N1CCCc1ccncc1 |
| InChI | InChI=1S/C17H25N3O/c1-2-10-18-13-9-16-5-6-17(21)20(16)14-3-4-15-7-11-19-12-8-15/h2,7-8,11-12,16,18H,1,3-6,9-10,13-14H2/t16-/m0/s1 |
| InChIKey | NMAHCPFYLUHSQE-INIZCTEOSA-N |
| XLogP | 2.17 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|