About 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione
5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione (PubChem CID 4243875) has the molecular formula C18H11BrN2O4
and a molecular weight of 399.20 g/mol. Its IUPAC name is 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione |
| PubChem CID | 4243875 |
| Molecular Formula | C18H11BrN2O4 |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione |
| SMILES | CCN1C(=O)c2ccc(-c3nc4ccc(Br)cc4c(=O)o3)cc2C1=O |
| InChI | InChI=1S/C18H11BrN2O4/c1-2-21-16(22)11-5-3-9(7-12(11)17(21)23)15-20-14-6-4-10(19)8-13(14)18(24)25-15/h3-8H,2H2,1H3 |
| InChIKey | OJDFNWHPYWPOPI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione?
The IUPAC name of 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione (CID 4243875) is 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione.
What is the SMILES notation for 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione?
The canonical SMILES for 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione is CCN1C(=O)c2ccc(-c3nc4ccc(Br)cc4c(=O)o3)cc2C1=O.
What is the InChIKey of 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione?
The InChIKey is OJDFNWHPYWPOPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11BrN2O4/c1-2-21-16(22)11-5-3-9(7-12(11)17(21)23)15-20-14-6-4-10(19)8-13(14)18(24)25-15/h3-8H,2H2,1H3.
What are the key properties of 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione?
5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione has a molecular weight of 399.20 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-bromo-4-oxo-3,1-benzoxazin-2-yl)-2-ethylisoindole-1,3-dione is sourced from PubChem (CID 4243875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).