C22H18N2O3 — CID 4244003
[4-[(benzoylhydrazinylidene)methyl]phenyl] 3-methylbenzoate (PubChem CID 4244003) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is [4-[(benzoylhydrazinylidene)methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-[(benzoylhydrazinylidene)methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 4244003 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [4-[(benzoylhydrazinylidene)methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(C=NNC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H18N2O3/c1-16-6-5-9-19(14-16)22(26)27-20-12-10-17(11-13-20)15-23-24-21(25)18-7-3-2-4-8-18/h2-15H,1H3,(H,24,25) |
| InChIKey | IIJYBBZYFYLXLK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|