C23H22N2OS — CID 4244032
N-(3-cyano-4-ethyl-5-methylthiophen-2-yl)-3,3-diphenylpropanamide (PubChem CID 4244032) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is N-(3-cyano-4-ethyl-5-methylthiophen-2-yl)-3,3-diphenylpropanamide.
| Compound Name | N-(3-cyano-4-ethyl-5-methylthiophen-2-yl)-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 4244032 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-(3-cyano-4-ethyl-5-methylthiophen-2-yl)-3,3-diphenylpropanamide |
| SMILES | CCc1c(C)sc(NC(=O)CC(c2ccccc2)c2ccccc2)c1C#N |
| InChI | InChI=1S/C23H22N2OS/c1-3-19-16(2)27-23(21(19)15-24)25-22(26)14-20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,20H,3,14H2,1-2H3,(H,25,26) |
| InChIKey | WJEXUZKEQAJTKB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |