About 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide
4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide (PubChem CID 4244251) has the molecular formula C13H12ClN5O3S
and a molecular weight of 353.79 g/mol. Its IUPAC name is 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide |
| PubChem CID | 4244251 |
| Molecular Formula | C13H12ClN5O3S |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)NC(=S)Nc2ccc([N+](=O)[O-])cc2)c1Cl |
| InChI | InChI=1S/C13H12ClN5O3S/c1-7-10(14)11(18(2)17-7)12(20)16-13(23)15-8-3-5-9(6-4-8)19(21)22/h3-6H,1-2H3,(H2,15,16,20,23) |
| InChIKey | UKPVEHDSFDPUMM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide?
The IUPAC name of 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide (CID 4244251) is 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide.
What is the SMILES notation for 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide?
The canonical SMILES for 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide is Cc1nn(C)c(C(=O)NC(=S)Nc2ccc([N+](=O)[O-])cc2)c1Cl.
What is the InChIKey of 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide?
The InChIKey is UKPVEHDSFDPUMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN5O3S/c1-7-10(14)11(18(2)17-7)12(20)16-13(23)15-8-3-5-9(6-4-8)19(21)22/h3-6H,1-2H3,(H2,15,16,20,23).
What are the key properties of 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide?
4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide has a molecular weight of 353.79 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,3-dimethyl-N-[(4-nitrophenyl)carbamothioyl]pyrazole-5-carboxamide is sourced from PubChem (CID 4244251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).