C26H25F3N2O2S — CID 42448959
N-[(1R,2R)-2-methoxy-1'-[(2,3,6-trifluorophenyl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]thiophene-2-carboxamide (PubChem CID 42448959) has the molecular formula C26H25F3N2O2S and a molecular weight of 486.56 g/mol. Its IUPAC name is N-[(1R,2R)-2-methoxy-1'-[(2,3,6-trifluorophenyl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]thiophene-2-carboxamide.
| Compound Name | N-[(1R,2R)-2-methoxy-1'-[(2,3,6-trifluorophenyl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42448959 |
| Molecular Formula | C26H25F3N2O2S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[(1R,2R)-2-methoxy-1'-[(2,3,6-trifluorophenyl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]thiophene-2-carboxamide |
| SMILES | CO[C@H]1[C@H](NC(=O)c2cccs2)c2ccccc2C12CCN(Cc1c(F)ccc(F)c1F)CC2 |
| InChI | InChI=1S/C26H25F3N2O2S/c1-33-24-23(30-25(32)21-7-4-14-34-21)16-5-2-3-6-18(16)26(24)10-12-31(13-11-26)15-17-19(27)8-9-20(28)22(17)29/h2-9,14,23-24H,10-13,15H2,1H3,(H,30,32)/t23-,24+/m1/s1 |
| InChIKey | SAKGODNYPHILFS-RPWUZVMVSA-N |
| XLogP | 5.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|