C19H22N4O2S — CID 42450236
(2S)-N-(cyclopropylcarbamoyl)-2-(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylpropanamide (PubChem CID 42450236) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is (2S)-N-(cyclopropylcarbamoyl)-2-(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(cyclopropylcarbamoyl)-2-(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 42450236 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2S)-N-(cyclopropylcarbamoyl)-2-(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1ncc(-c2ccccc2)n1C1CC1)C(=O)NC(=O)NC1CC1 |
| InChI | InChI=1S/C19H22N4O2S/c1-12(17(24)22-18(25)21-14-7-8-14)26-19-20-11-16(23(19)15-9-10-15)13-5-3-2-4-6-13/h2-6,11-12,14-15H,7-10H2,1H3,(H2,21,22,24,25)/t12-/m0/s1 |
| InChIKey | INDRRESSCDWEHP-LBPRGKRZSA-N |
| XLogP | 3.35 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |