C21H30N4O2S — CID 42451286
1-[4-(dimethylsulfamoylamino)phenyl]-4-[[(1S)-1-phenylethyl]amino]piperidine (PubChem CID 42451286) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is 1-[4-(dimethylsulfamoylamino)phenyl]-4-[[(1S)-1-phenylethyl]amino]piperidine.
| Compound Name | 1-[4-(dimethylsulfamoylamino)phenyl]-4-[[(1S)-1-phenylethyl]amino]piperidine |
|---|---|
| PubChem CID | 42451286 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-[4-(dimethylsulfamoylamino)phenyl]-4-[[(1S)-1-phenylethyl]amino]piperidine |
| SMILES | C[C@H](NC1CCN(c2ccc(NS(=O)(=O)N(C)C)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H30N4O2S/c1-17(18-7-5-4-6-8-18)22-19-13-15-25(16-14-19)21-11-9-20(10-12-21)23-28(26,27)24(2)3/h4-12,17,19,22-23H,13-16H2,1-3H3/t17-/m0/s1 |
| InChIKey | UOHOMEOVDFVHMM-KRWDZBQOSA-N |
| XLogP | 3.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|