C20H28N4O3S — CID 42452627
N-butyl-1-(4-methyl-7-methylsulfonylquinazolin-2-yl)piperidine-4-carboxamide (PubChem CID 42452627) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-butyl-1-(4-methyl-7-methylsulfonylquinazolin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-butyl-1-(4-methyl-7-methylsulfonylquinazolin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42452627 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-butyl-1-(4-methyl-7-methylsulfonylquinazolin-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2nc(C)c3ccc(S(C)(=O)=O)cc3n2)CC1 |
| InChI | InChI=1S/C20H28N4O3S/c1-4-5-10-21-19(25)15-8-11-24(12-9-15)20-22-14(2)17-7-6-16(28(3,26)27)13-18(17)23-20/h6-7,13,15H,4-5,8-12H2,1-3H3,(H,21,25) |
| InChIKey | KZPCFLJQFXKNEC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|