About (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine
(2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine (PubChem CID 42453597) has the molecular formula C20H28N4
and a molecular weight of 324.47 g/mol. Its IUPAC name is (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine |
| PubChem CID | 42453597 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine |
| SMILES | CCc1[nH]c2ccc(CN[C@@H](C)Cn3nc(C)cc3C)cc2c1C |
| InChI | InChI=1S/C20H28N4/c1-6-19-16(5)18-10-17(7-8-20(18)22-19)11-21-14(3)12-24-15(4)9-13(2)23-24/h7-10,14,21-22H,6,11-12H2,1-5H3/t14-/m0/s1 |
| InChIKey | KLYTVZUDSOXNSK-AWEZNQCLSA-N |
| XLogP | 4.03 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine?
The IUPAC name of (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine (CID 42453597) is (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine.
What is the SMILES notation for (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine?
The canonical SMILES for (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine is CCc1[nH]c2ccc(CN[C@@H](C)Cn3nc(C)cc3C)cc2c1C.
What is the InChIKey of (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine?
The InChIKey is KLYTVZUDSOXNSK-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H28N4/c1-6-19-16(5)18-10-17(7-8-20(18)22-19)11-21-14(3)12-24-15(4)9-13(2)23-24/h7-10,14,21-22H,6,11-12H2,1-5H3/t14-/m0/s1.
What are the key properties of (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine?
(2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine has a molecular weight of 324.47 g/mol, XLogP of 4.03, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(3,5-dimethylpyrazol-1-yl)-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]propan-2-amine is sourced from PubChem (CID 42453597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).