C21H31N3O3S — CID 42454774
1-[[2-benzylsulfonyl-3-(2-methylpropyl)imidazol-4-yl]methyl]-4-methoxypiperidine (PubChem CID 42454774) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 1-[[2-benzylsulfonyl-3-(2-methylpropyl)imidazol-4-yl]methyl]-4-methoxypiperidine.
| Compound Name | 1-[[2-benzylsulfonyl-3-(2-methylpropyl)imidazol-4-yl]methyl]-4-methoxypiperidine |
|---|---|
| PubChem CID | 42454774 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-[[2-benzylsulfonyl-3-(2-methylpropyl)imidazol-4-yl]methyl]-4-methoxypiperidine |
| SMILES | COC1CCN(Cc2cnc(S(=O)(=O)Cc3ccccc3)n2CC(C)C)CC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-17(2)14-24-19(15-23-11-9-20(27-3)10-12-23)13-22-21(24)28(25,26)16-18-7-5-4-6-8-18/h4-8,13,17,20H,9-12,14-16H2,1-3H3 |
| InChIKey | XOXKJFQRDQWVPE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |