C24H33N3O — CID 42454883
N-ethyl-N-[[1-[2-(2-methylphenyl)ethyl]piperidin-4-yl]methyl]-2-pyridin-4-ylacetamide (PubChem CID 42454883) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is N-ethyl-N-[[1-[2-(2-methylphenyl)ethyl]piperidin-4-yl]methyl]-2-pyridin-4-ylacetamide.
| Compound Name | N-ethyl-N-[[1-[2-(2-methylphenyl)ethyl]piperidin-4-yl]methyl]-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 42454883 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | N-ethyl-N-[[1-[2-(2-methylphenyl)ethyl]piperidin-4-yl]methyl]-2-pyridin-4-ylacetamide |
| SMILES | CCN(CC1CCN(CCc2ccccc2C)CC1)C(=O)Cc1ccncc1 |
| InChI | InChI=1S/C24H33N3O/c1-3-27(24(28)18-21-8-13-25-14-9-21)19-22-10-15-26(16-11-22)17-12-23-7-5-4-6-20(23)2/h4-9,13-14,22H,3,10-12,15-19H2,1-2H3 |
| InChIKey | QOFNUFJQKRLFTD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |