C47H53ClFNO6 — CID 4245571
N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 4245571) has the molecular formula C47H53ClFNO6 and a molecular weight of 782.39 g/mol. Its IUPAC name is N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4245571 |
| Molecular Formula | C47H53ClFNO6 |
| Molecular Weight | 782.39 g/mol |
| Exact Mass | 781.35 |
| IUPAC Name | N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N(Cc2ccccc2)CC2(O)CCC3C45C=CC6(C=C4C(=O)Cc4c(F)cccc4Cl)CC(O)CCC6(C)C5CCC32C)cc1OC |
| InChI | InChI=1S/C47H53ClFNO6/c1-43-18-15-32(51)26-45(43)21-22-47(34(27-45)37(52)25-33-35(48)11-8-12-36(33)49)40(43)16-19-44(2)41(47)17-20-46(44,54)29-50(28-30-9-6-5-7-10-30)42(53)24-31-13-14-38(55-3)39(23-31)56-4/h5-14,21-23,27,32,40-41,51,54H,15-20,24-26,28-29H2,1-4H3 |
| InChIKey | BWKBXERYDZIICB-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.39 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|