C23H21ClN2O4S — CID 42456290
(5S,10bR)-9-chloro-2-thiophen-2-yl-5-(2,3,4-trimethoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 42456290) has the molecular formula C23H21ClN2O4S and a molecular weight of 456.95 g/mol. Its IUPAC name is (5S,10bR)-9-chloro-2-thiophen-2-yl-5-(2,3,4-trimethoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5S,10bR)-9-chloro-2-thiophen-2-yl-5-(2,3,4-trimethoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 42456290 |
| Molecular Formula | C23H21ClN2O4S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (5S,10bR)-9-chloro-2-thiophen-2-yl-5-(2,3,4-trimethoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | COc1ccc([C@@H]2Oc3ccc(Cl)cc3[C@H]3CC(c4cccs4)=NN32)c(OC)c1OC |
| InChI | InChI=1S/C23H21ClN2O4S/c1-27-19-9-7-14(21(28-2)22(19)29-3)23-26-17(12-16(25-26)20-5-4-10-31-20)15-11-13(24)6-8-18(15)30-23/h4-11,17,23H,12H2,1-3H3/t17-,23+/m1/s1 |
| InChIKey | OIOJIFFFYFYUJF-HXOBKFHXSA-N |
| XLogP | 5.67 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |