C22H32N2O — CID 42457135
2-(cyclohexen-1-yl)-N-[(3S)-1-(3-phenylpropyl)piperidin-3-yl]acetamide (PubChem CID 42457135) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[(3S)-1-(3-phenylpropyl)piperidin-3-yl]acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-[(3S)-1-(3-phenylpropyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 42457135 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[(3S)-1-(3-phenylpropyl)piperidin-3-yl]acetamide |
| SMILES | O=C(CC1=CCCCC1)N[C@H]1CCCN(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C22H32N2O/c25-22(17-20-11-5-2-6-12-20)23-21-14-8-16-24(18-21)15-7-13-19-9-3-1-4-10-19/h1,3-4,9-11,21H,2,5-8,12-18H2,(H,23,25)/t21-/m0/s1 |
| InChIKey | CIBLOQWCTKWSDL-NRFANRHFSA-N |
| XLogP | 4.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|