About 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol
2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol (PubChem CID 4245763) has the molecular formula C20H13FN2OS
and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol.
Molecular Properties
| Compound Name | 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol |
| PubChem CID | 4245763 |
| Molecular Formula | C20H13FN2OS |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol |
| SMILES | Oc1c(F)cccc1/C=N/c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H13FN2OS/c21-16-5-3-4-14(19(16)24)12-22-15-10-8-13(9-11-15)20-23-17-6-1-2-7-18(17)25-20/h1-12,24H/b22-12+ |
| InChIKey | UAPRECBKXBHINP-WSDLNYQXSA-N |
| XLogP | 5.56 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol?
The IUPAC name of 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol (CID 4245763) is 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol.
What is the SMILES notation for 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol?
The canonical SMILES for 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol is Oc1c(F)cccc1/C=N/c1ccc(-c2nc3ccccc3s2)cc1.
What is the InChIKey of 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol?
The InChIKey is UAPRECBKXBHINP-WSDLNYQXSA-N. The full InChI is InChI=1S/C20H13FN2OS/c21-16-5-3-4-14(19(16)24)12-22-15-10-8-13(9-11-15)20-23-17-6-1-2-7-18(17)25-20/h1-12,24H/b22-12+.
What are the key properties of 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol?
2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol has a molecular weight of 348.40 g/mol, XLogP of 5.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-fluorophenol is sourced from PubChem (CID 4245763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).