About 1-benzyl-1,2,4-triazol-4-ium-4-amine
1-benzyl-1,2,4-triazol-4-ium-4-amine (PubChem CID 4245910) has the molecular formula C9H11N4+
and a molecular weight of 175.22 g/mol. Its IUPAC name is 1-benzyl-1,2,4-triazol-4-ium-4-amine.
Molecular Properties
| Compound Name | 1-benzyl-1,2,4-triazol-4-ium-4-amine |
| PubChem CID | 4245910 |
| Molecular Formula | C9H11N4+ |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-benzyl-1,2,4-triazol-4-ium-4-amine |
| SMILES | N[n+]1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C9H11N4/c10-12-7-11-13(8-12)6-9-4-2-1-3-5-9/h1-5,7-8H,6,10H2/q+1 |
| InChIKey | MZZHPMYCXKSQDX-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-1,2,4-triazol-4-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1,2,4-triazol-4-ium-4-amine?
The IUPAC name of 1-benzyl-1,2,4-triazol-4-ium-4-amine (CID 4245910) is 1-benzyl-1,2,4-triazol-4-ium-4-amine.
What is the SMILES notation for 1-benzyl-1,2,4-triazol-4-ium-4-amine?
The canonical SMILES for 1-benzyl-1,2,4-triazol-4-ium-4-amine is N[n+]1cnn(Cc2ccccc2)c1.
What is the InChIKey of 1-benzyl-1,2,4-triazol-4-ium-4-amine?
The InChIKey is MZZHPMYCXKSQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N4/c10-12-7-11-13(8-12)6-9-4-2-1-3-5-9/h1-5,7-8H,6,10H2/q+1.
What are the key properties of 1-benzyl-1,2,4-triazol-4-ium-4-amine?
1-benzyl-1,2,4-triazol-4-ium-4-amine has a molecular weight of 175.22 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1,2,4-triazol-4-ium-4-amine is sourced from PubChem (CID 4245910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).